C17H25F3N4O5S — CID 155840523
N-[[(1S,3aS,7aS)-5-(5-ethylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155840523) has the molecular formula C17H25F3N4O5S and a molecular weight of 454.47 g/mol. Its IUPAC name is N-[[(1S,3aS,7aS)-5-(5-ethylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(1S,3aS,7aS)-5-(5-ethylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155840523 |
| Molecular Formula | C17H25F3N4O5S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-[[(1S,3aS,7aS)-5-(5-ethylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCc1cnc(N2CC[C@H]3[C@H](CO[C@@H]3CNS(C)(=O)=O)C2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4O3S.C2HF3O2/c1-3-11-6-16-15(17-7-11)19-5-4-13-12(9-19)10-22-14(13)8-18-23(2,20)21;3-2(4,5)1(6)7/h6-7,12-14,18H,3-5,8-10H2,1-2H3;(H,6,7)/t12-,13-,14+;/m0./s1 |
| InChIKey | LFBRWMDQIUWRHG-NPTJMSEESA-N |
| XLogP | 1.06 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |