C22H25F7N4O6 — CID 155841022
2-[7-[[(4-fluorophenyl)methylamino]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-2-yl]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155841022) has the molecular formula C22H25F7N4O6 and a molecular weight of 574.45 g/mol. Its IUPAC name is 2-[7-[[(4-fluorophenyl)methylamino]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-2-yl]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[7-[[(4-fluorophenyl)methylamino]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-2-yl]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155841022 |
| Molecular Formula | C22H25F7N4O6 |
| Molecular Weight | 574.45 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 2-[7-[[(4-fluorophenyl)methylamino]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-2-yl]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)C(=O)Cn1cc2c(n1)C(CNCc1ccc(F)cc1)OCC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23FN4O2.2C2HF3O2/c1-22(2)17(24)12-23-11-14-7-8-25-16(18(14)21-23)10-20-9-13-3-5-15(19)6-4-13;2*3-2(4,5)1(6)7/h3-6,11,16,20H,7-10,12H2,1-2H3;2*(H,6,7) |
| InChIKey | BJOHCYJPLHCURO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |