About 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene
1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene (PubChem CID 15584106) has the molecular formula C16H14F2O2
and a molecular weight of 276.28 g/mol. Its IUPAC name is 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene.
Molecular Properties
| Compound Name | 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene |
| PubChem CID | 15584106 |
| Molecular Formula | C16H14F2O2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene |
| SMILES | COc1ccc(/C(F)=C(\F)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C16H14F2O2/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10H,1-2H3/b16-15+ |
| InChIKey | MUFHCTBBUXEICJ-FOCLMDBBSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene?
The IUPAC name of 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene (CID 15584106) is 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene.
What is the SMILES notation for 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene?
The canonical SMILES for 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene is COc1ccc(/C(F)=C(\F)c2ccc(OC)cc2)cc1.
What is the InChIKey of 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene?
The InChIKey is MUFHCTBBUXEICJ-FOCLMDBBSA-N. The full InChI is InChI=1S/C16H14F2O2/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10H,1-2H3/b16-15+.
What are the key properties of 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene?
1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene has a molecular weight of 276.28 g/mol, XLogP of 4.47, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene is sourced from PubChem (CID 15584106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).