C19H23F3N6O3S — CID 155841754
[4-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155841754) has the molecular formula C19H23F3N6O3S and a molecular weight of 472.49 g/mol. Its IUPAC name is [4-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841754 |
| Molecular Formula | C19H23F3N6O3S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [4-(4-methylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCN(c2ncnc3c2CCN(C(=O)c2cscn2)CC3)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N6OS.C2HF3O2/c1-21-6-8-22(9-7-21)16-13-2-4-23(5-3-14(13)18-11-19-16)17(24)15-10-25-12-20-15;3-2(4,5)1(6)7/h10-12H,2-9H2,1H3;(H,6,7) |
| InChIKey | SEUXJEPVOKQYSH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |