C16H25F3N4O5S — CID 155841769
N-[[(3S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155841769) has the molecular formula C16H25F3N4O5S and a molecular weight of 442.46 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841769 |
| Molecular Formula | C16H25F3N4O5S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)NC[C@H]1CO[C@@H]2CN(Cc3cnn(C)c3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H24N4O3S.C2HF3O2/c1-3-22(19,20)16-5-12-10-21-14-9-18(8-13(12)14)7-11-4-15-17(2)6-11;3-2(4,5)1(6)7/h4,6,12-14,16H,3,5,7-10H2,1-2H3;(H,6,7)/t12-,13+,14+;/m0./s1 |
| InChIKey | CBIOONRKKFBCFH-SOIKFHLCSA-N |
| XLogP | 0.44 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |