C18H20F3N3O2S — CID 155841830
7-(cyclopropylmethyl)-4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid (PubChem CID 155841830) has the molecular formula C18H20F3N3O2S and a molecular weight of 399.44 g/mol. Its IUPAC name is 7-(cyclopropylmethyl)-4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-(cyclopropylmethyl)-4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841830 |
| Molecular Formula | C18H20F3N3O2S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 7-(cyclopropylmethyl)-4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1nc2c(c(-c3ccsc3)n1)CCN(CC1CC1)CC2 |
| InChI | InChI=1S/C16H19N3S.C2HF3O2/c1-2-12(1)9-19-6-3-14-15(4-7-19)17-11-18-16(14)13-5-8-20-10-13;3-2(4,5)1(6)7/h5,8,10-12H,1-4,6-7,9H2;(H,6,7) |
| InChIKey | AUPDDFTXSSNZRR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |