C16H19F3N4O5S — CID 155842250
N-[[2-(2-methoxyethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155842250) has the molecular formula C16H19F3N4O5S and a molecular weight of 436.41 g/mol. Its IUPAC name is N-[[2-(2-methoxyethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[2-(2-methoxyethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155842250 |
| Molecular Formula | C16H19F3N4O5S |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | N-[[2-(2-methoxyethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCn1cc2c(n1)C(CNC(=O)c1cscn1)OCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18N4O3S.C2HF3O2/c1-20-5-3-18-7-10-2-4-21-12(13(10)17-18)6-15-14(19)11-8-22-9-16-11;3-2(4,5)1(6)7/h7-9,12H,2-6H2,1H3,(H,15,19);(H,6,7) |
| InChIKey | ULDAIABGFWWMHF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |