C14H20F6N4O4 — CID 155842484
N,N-dimethyl-1-(6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl)methanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155842484) has the molecular formula C14H20F6N4O4 and a molecular weight of 422.33 g/mol. Its IUPAC name is N,N-dimethyl-1-(6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl)methanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-1-(6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl)methanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155842484 |
| Molecular Formula | C14H20F6N4O4 |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N,N-dimethyl-1-(6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl)methanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)Cc1ncn2c1CNCCC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H18N4.2C2HF3O2/c1-13(2)7-9-10-6-11-4-3-5-14(10)8-12-9;2*3-2(4,5)1(6)7/h8,11H,3-7H2,1-2H3;2*(H,6,7) |
| InChIKey | UVWRQXQSDXIITJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |