C17H20F3N5O4S — CID 155842497
1'-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 155842497) has the molecular formula C17H20F3N5O4S and a molecular weight of 447.44 g/mol. Its IUPAC name is 1'-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 1'-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155842497 |
| Molecular Formula | C17H20F3N5O4S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 1'-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]spiro[6,7-dihydropyrrolo[2,1-c][1,2,4]triazine-8,3'-pyrrolidine]-3,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(Cn2nc3n(c(=O)c2=O)CCC32CCN(C)C2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19N5O2S.C2HF3O2/c1-10-16-11(8-23-10)7-20-13(22)12(21)19-6-4-15(14(19)17-20)3-5-18(2)9-15;3-2(4,5)1(6)7/h8H,3-7,9H2,1-2H3;(H,6,7) |
| InChIKey | DNDYMAMNBXAMNF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|