C20H24F6N6O5 — CID 155842524
N-[[(3S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155842524) has the molecular formula C20H24F6N6O5 and a molecular weight of 542.44 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[[(3S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155842524 |
| Molecular Formula | C20H24F6N6O5 |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc(CN2C[C@@H]3[C@@H](CNc4ncccn4)CO[C@@H]3C2)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N6O.2C2HF3O2/c1-21-7-12(5-20-21)8-22-9-14-13(11-23-15(14)10-22)6-19-16-17-3-2-4-18-16;2*3-2(4,5)1(6)7/h2-5,7,13-15H,6,8-11H2,1H3,(H,17,18,19);2*(H,6,7)/t13-,14+,15+;;/m0../s1 |
| InChIKey | ZDYSRDUNXJTNOS-ZFSDTUNKSA-N |
| XLogP | 2.04 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |