C25H30F3N5O4S — CID 155843061
(4-methyl-1,4-diazepan-1-yl)-[2-[6-(4-methylpiperidin-1-yl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155843061) has the molecular formula C25H30F3N5O4S and a molecular weight of 553.61 g/mol. Its IUPAC name is (4-methyl-1,4-diazepan-1-yl)-[2-[6-(4-methylpiperidin-1-yl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (4-methyl-1,4-diazepan-1-yl)-[2-[6-(4-methylpiperidin-1-yl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155843061 |
| Molecular Formula | C25H30F3N5O4S |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | (4-methyl-1,4-diazepan-1-yl)-[2-[6-(4-methylpiperidin-1-yl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | CC1CCN(c2ccc3c(-c4ncc(C(=O)N5CCCN(C)CC5)s4)noc3c2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H29N5O2S.C2HF3O2/c1-16-6-10-27(11-7-16)17-4-5-18-19(14-17)30-25-21(18)22-24-15-20(31-22)23(29)28-9-3-8-26(2)12-13-28;3-2(4,5)1(6)7/h4-5,14-16H,3,6-13H2,1-2H3;(H,6,7) |
| InChIKey | NZVUGWPWKVQBKX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |