C19H21F3N4O5 — CID 155843314
2-(dimethylamino)-7-(1H-pyrrole-2-carbonyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 155843314) has the molecular formula C19H21F3N4O5 and a molecular weight of 442.39 g/mol. Its IUPAC name is 2-(dimethylamino)-7-(1H-pyrrole-2-carbonyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(dimethylamino)-7-(1H-pyrrole-2-carbonyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155843314 |
| Molecular Formula | C19H21F3N4O5 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-(dimethylamino)-7-(1H-pyrrole-2-carbonyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)c1nc2c(cc1C(=O)O)CCN(C(=O)c1ccc[nH]1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20N4O3.C2HF3O2/c1-20(2)15-12(17(23)24)10-11-5-8-21(9-6-13(11)19-15)16(22)14-4-3-7-18-14;3-2(4,5)1(6)7/h3-4,7,10,18H,5-6,8-9H2,1-2H3,(H,23,24);(H,6,7) |
| InChIKey | DVHMVHHLPKZYRV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |