C24H31F3N4O4 — CID 155843456
1'-(3-methylbutyl)-N-phenylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155843456) has the molecular formula C24H31F3N4O4 and a molecular weight of 496.53 g/mol. Its IUPAC name is 1'-(3-methylbutyl)-N-phenylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1'-(3-methylbutyl)-N-phenylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155843456 |
| Molecular Formula | C24H31F3N4O4 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 1'-(3-methylbutyl)-N-phenylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CCN1CCC2(CC1)OC(C(=O)Nc1ccccc1)Cn1ccnc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H30N4O2.C2HF3O2/c1-17(2)8-12-25-13-9-22(10-14-25)21-23-11-15-26(21)16-19(28-22)20(27)24-18-6-4-3-5-7-18;3-2(4,5)1(6)7/h3-7,11,15,17,19H,8-10,12-14,16H2,1-2H3,(H,24,27);(H,6,7) |
| InChIKey | ARZPRNYCJSSJNK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |