C18H23F3N4O4 — CID 155843495
[(3S,3aS,6aS)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-cyclobutylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155843495) has the molecular formula C18H23F3N4O4 and a molecular weight of 416.40 g/mol. Its IUPAC name is [(3S,3aS,6aS)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-cyclobutylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3S,3aS,6aS)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-cyclobutylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155843495 |
| Molecular Formula | C18H23F3N4O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [(3S,3aS,6aS)-3-[(pyrimidin-2-ylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-cyclobutylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C1CCC1)N1C[C@@H]2[C@@H](CNc3ncccn3)CO[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N4O2.C2HF3O2/c21-15(11-3-1-4-11)20-8-13-12(10-22-14(13)9-20)7-19-16-17-5-2-6-18-16;3-2(4,5)1(6)7/h2,5-6,11-14H,1,3-4,7-10H2,(H,17,18,19);(H,6,7)/t12-,13+,14+;/m0./s1 |
| InChIKey | AJKSIXBTLRFPKR-SOIKFHLCSA-N |
| XLogP | 1.80 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |