C22H21F6N3O5S — CID 155843920
2-(3,4-difluorophenyl)sulfonyl-9-(3-fluorophenyl)-6-methyl-2,6,9-triazaspiro[4.5]decan-8-one;2,2,2-trifluoroacetic acid (PubChem CID 155843920) has the molecular formula C22H21F6N3O5S and a molecular weight of 553.48 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfonyl-9-(3-fluorophenyl)-6-methyl-2,6,9-triazaspiro[4.5]decan-8-one;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(3,4-difluorophenyl)sulfonyl-9-(3-fluorophenyl)-6-methyl-2,6,9-triazaspiro[4.5]decan-8-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155843920 |
| Molecular Formula | C22H21F6N3O5S |
| Molecular Weight | 553.48 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfonyl-9-(3-fluorophenyl)-6-methyl-2,6,9-triazaspiro[4.5]decan-8-one;2,2,2-trifluoroacetic acid |
| SMILES | CN1CC(=O)N(c2cccc(F)c2)CC12CCN(S(=O)(=O)c1ccc(F)c(F)c1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H20F3N3O3S.C2HF3O2/c1-24-11-19(27)26(15-4-2-3-14(21)9-15)13-20(24)7-8-25(12-20)30(28,29)16-5-6-17(22)18(23)10-16;3-2(4,5)1(6)7/h2-6,9-10H,7-8,11-13H2,1H3;(H,6,7) |
| InChIKey | AJKGOFYCDDURAL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |