C20H16O4S2 — CID 15584393
dimethyl 3,6-diphenyl-1,4-dithiine-2,5-dicarboxylate (PubChem CID 15584393) has the molecular formula C20H16O4S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is dimethyl 3,6-diphenyl-1,4-dithiine-2,5-dicarboxylate.
| Compound Name | dimethyl 3,6-diphenyl-1,4-dithiine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 15584393 |
| Molecular Formula | C20H16O4S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | dimethyl 3,6-diphenyl-1,4-dithiine-2,5-dicarboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)SC(C(=O)OC)=C(c2ccccc2)S1 |
| InChI | InChI=1S/C20H16O4S2/c1-23-19(21)17-15(13-9-5-3-6-10-13)26-18(20(22)24-2)16(25-17)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | HNLLIYDWCIANHI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |