C18H25F3N4O4S — CID 155844579
N,N-dimethyl-2-[(5S,9S)-9-methyl-1-oxo-7-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-2-yl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155844579) has the molecular formula C18H25F3N4O4S and a molecular weight of 450.48 g/mol. Its IUPAC name is N,N-dimethyl-2-[(5S,9S)-9-methyl-1-oxo-7-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-2-yl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-2-[(5S,9S)-9-methyl-1-oxo-7-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-2-yl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155844579 |
| Molecular Formula | C18H25F3N4O4S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N,N-dimethyl-2-[(5S,9S)-9-methyl-1-oxo-7-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-2-yl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | C[C@@H]1CN(Cc2nccs2)C[C@]12CCN(CC(=O)N(C)C)C2=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O2S.C2HF3O2/c1-12-8-19(9-13-17-5-7-23-13)11-16(12)4-6-20(15(16)22)10-14(21)18(2)3;3-2(4,5)1(6)7/h5,7,12H,4,6,8-11H2,1-3H3;(H,6,7)/t12-,16-;/m1./s1 |
| InChIKey | BQWDPPAUURJHDW-VQZRABBESA-N |
| XLogP | 1.53 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |