C18H21F3N6O5 — CID 155844788
[3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-pyridazin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155844788) has the molecular formula C18H21F3N6O5 and a molecular weight of 458.40 g/mol. Its IUPAC name is [3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-pyridazin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-pyridazin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155844788 |
| Molecular Formula | C18H21F3N6O5 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [3-[4-(2-methoxyethylamino)pyrimidin-2-yl]morpholin-4-yl]-pyridazin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | COCCNc1ccnc(C2COCCN2C(=O)c2ccnnc2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H20N6O3.C2HF3O2/c1-24-8-6-17-14-3-4-18-15(21-14)13-11-25-9-7-22(13)16(23)12-2-5-19-20-10-12;3-2(4,5)1(6)7/h2-5,10,13H,6-9,11H2,1H3,(H,17,18,21);(H,6,7) |
| InChIKey | ZUQNDBJULZHLFM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 139.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|