C20H28F3N3O5 — CID 155844888
N,N-dimethyl-2-[(5S,9S)-9-methyl-7-[(5-methylfuran-2-yl)methyl]-1-oxo-2,7-diazaspiro[4.4]nonan-2-yl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155844888) has the molecular formula C20H28F3N3O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[(5S,9S)-9-methyl-7-[(5-methylfuran-2-yl)methyl]-1-oxo-2,7-diazaspiro[4.4]nonan-2-yl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-2-[(5S,9S)-9-methyl-7-[(5-methylfuran-2-yl)methyl]-1-oxo-2,7-diazaspiro[4.4]nonan-2-yl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155844888 |
| Molecular Formula | C20H28F3N3O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N,N-dimethyl-2-[(5S,9S)-9-methyl-7-[(5-methylfuran-2-yl)methyl]-1-oxo-2,7-diazaspiro[4.4]nonan-2-yl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2C[C@@H](C)[C@@]3(CCN(CC(=O)N(C)C)C3=O)C2)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O3.C2HF3O2/c1-13-9-20(10-15-6-5-14(2)24-15)12-18(13)7-8-21(17(18)23)11-16(22)19(3)4;3-2(4,5)1(6)7/h5-6,13H,7-12H2,1-4H3;(H,6,7)/t13-,18-;/m1./s1 |
| InChIKey | IEUFZWYXEOVFLJ-QRGZVCNKSA-N |
| XLogP | 1.98 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |