About dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate
dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate (PubChem CID 15584510) has the molecular formula C8H13NO4S
and a molecular weight of 219.26 g/mol. Its IUPAC name is dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate |
| PubChem CID | 15584510 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CSC[C@@H](C(=O)OC)N1 |
| InChI | InChI=1S/C8H13NO4S/c1-12-7(10)5-3-14-4-6(9-5)8(11)13-2/h5-6,9H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | VMESBEKJQGXCOL-WDSKDSINSA-N |
| XLogP | -0.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate?
The IUPAC name of dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate (CID 15584510) is dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate.
What is the SMILES notation for dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate?
The canonical SMILES for dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate is COC(=O)[C@@H]1CSC[C@@H](C(=O)OC)N1.
What is the InChIKey of dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate?
The InChIKey is VMESBEKJQGXCOL-WDSKDSINSA-N. The full InChI is InChI=1S/C8H13NO4S/c1-12-7(10)5-3-14-4-6(9-5)8(11)13-2/h5-6,9H,3-4H2,1-2H3/t5-,6-/m0/s1.
What are the key properties of dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate?
dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate has a molecular weight of 219.26 g/mol, XLogP of -0.59, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (3R,5R)-thiomorpholine-3,5-dicarboxylate is sourced from PubChem (CID 15584510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).