About 1-chloro-3,5,7-trimethyladamantane
1-chloro-3,5,7-trimethyladamantane (PubChem CID 15584515) has the molecular formula C13H21Cl
and a molecular weight of 212.76 g/mol. Its IUPAC name is 1-chloro-3,5,7-trimethyladamantane.
Molecular Properties
| Compound Name | 1-chloro-3,5,7-trimethyladamantane |
| PubChem CID | 15584515 |
| Molecular Formula | C13H21Cl |
| Molecular Weight | 212.76 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-chloro-3,5,7-trimethyladamantane |
| SMILES | CC12CC3(C)CC(C)(C1)CC(Cl)(C2)C3 |
| InChI | InChI=1S/C13H21Cl/c1-10-4-11(2)6-12(3,5-10)9-13(14,7-10)8-11/h4-9H2,1-3H3 |
| InChIKey | OGORHYWIGXHYKE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.76 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3,5,7-trimethyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3,5,7-trimethyladamantane?
The IUPAC name of 1-chloro-3,5,7-trimethyladamantane (CID 15584515) is 1-chloro-3,5,7-trimethyladamantane.
What is the SMILES notation for 1-chloro-3,5,7-trimethyladamantane?
The canonical SMILES for 1-chloro-3,5,7-trimethyladamantane is CC12CC3(C)CC(C)(C1)CC(Cl)(C2)C3.
What is the InChIKey of 1-chloro-3,5,7-trimethyladamantane?
The InChIKey is OGORHYWIGXHYKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21Cl/c1-10-4-11(2)6-12(3,5-10)9-13(14,7-10)8-11/h4-9H2,1-3H3.
What are the key properties of 1-chloro-3,5,7-trimethyladamantane?
1-chloro-3,5,7-trimethyladamantane has a molecular weight of 212.76 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3,5,7-trimethyladamantane is sourced from PubChem (CID 15584515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).