C19H26F3N3O5S — CID 155845440
2-[(3aR,7S,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155845440) has the molecular formula C19H26F3N3O5S and a molecular weight of 465.49 g/mol. Its IUPAC name is 2-[(3aR,7S,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3aR,7S,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845440 |
| Molecular Formula | C19H26F3N3O5S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-[(3aR,7S,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C[C@@H]1COC[C@H]2CN(Cc3nccs3)C[C@@H]12)N1CCCCO1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O3S.C2HF3O2/c21-17(20-4-1-2-5-23-20)7-13-11-22-12-14-8-19(9-15(13)14)10-16-18-3-6-24-16;3-2(4,5)1(6)7/h3,6,13-15H,1-2,4-5,7-12H2;(H,6,7)/t13-,14-,15+;/m1./s1 |
| InChIKey | XEWPYIIFPHOVGC-QRWISWEOSA-N |
| XLogP | 2.41 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |