About 5,5-dimethoxy-1,5-thiasilocane
5,5-dimethoxy-1,5-thiasilocane (PubChem CID 15584565) has the molecular formula C8H18O2SSi
and a molecular weight of 206.38 g/mol. Its IUPAC name is 5,5-dimethoxy-1,5-thiasilocane.
Molecular Properties
| Compound Name | 5,5-dimethoxy-1,5-thiasilocane |
| PubChem CID | 15584565 |
| Molecular Formula | C8H18O2SSi |
| Molecular Weight | 206.38 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 5,5-dimethoxy-1,5-thiasilocane |
| SMILES | CO[Si]1(OC)CCCSCCC1 |
| InChI | InChI=1S/C8H18O2SSi/c1-9-12(10-2)7-3-5-11-6-4-8-12/h3-8H2,1-2H3 |
| InChIKey | DXFDGSGYWNWHHT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethoxy-1,5-thiasilocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethoxy-1,5-thiasilocane?
The IUPAC name of 5,5-dimethoxy-1,5-thiasilocane (CID 15584565) is 5,5-dimethoxy-1,5-thiasilocane.
What is the SMILES notation for 5,5-dimethoxy-1,5-thiasilocane?
The canonical SMILES for 5,5-dimethoxy-1,5-thiasilocane is CO[Si]1(OC)CCCSCCC1.
What is the InChIKey of 5,5-dimethoxy-1,5-thiasilocane?
The InChIKey is DXFDGSGYWNWHHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2SSi/c1-9-12(10-2)7-3-5-11-6-4-8-12/h3-8H2,1-2H3.
What are the key properties of 5,5-dimethoxy-1,5-thiasilocane?
5,5-dimethoxy-1,5-thiasilocane has a molecular weight of 206.38 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethoxy-1,5-thiasilocane is sourced from PubChem (CID 15584565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).