C23H32F6N4O6 — CID 155845786
ethyl (3aS,8aR)-5-[(1-methylpyrazol-4-yl)methyl]-2-prop-2-enyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155845786) has the molecular formula C23H32F6N4O6 and a molecular weight of 574.52 g/mol. Its IUPAC name is ethyl (3aS,8aR)-5-[(1-methylpyrazol-4-yl)methyl]-2-prop-2-enyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | ethyl (3aS,8aR)-5-[(1-methylpyrazol-4-yl)methyl]-2-prop-2-enyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155845786 |
| Molecular Formula | C23H32F6N4O6 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | ethyl (3aS,8aR)-5-[(1-methylpyrazol-4-yl)methyl]-2-prop-2-enyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCN1C[C@@H]2CN(Cc3cnn(C)c3)CCC[C@]2(C(=O)OCC)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H30N4O2.2C2HF3O2/c1-4-8-23-14-17-13-22(12-16-10-20-21(3)11-16)9-6-7-19(17,15-23)18(24)25-5-2;2*3-2(4,5)1(6)7/h4,10-11,17H,1,5-9,12-15H2,2-3H3;2*(H,6,7)/t17-,19-;;/m0../s1 |
| InChIKey | DRAOMLQUTIJLCM-FFUVTKDNSA-N |
| XLogP | 2.95 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|