C20H24F3N3O4S — CID 155845849
4-[(5-methylthiophen-2-yl)methyl]-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155845849) has the molecular formula C20H24F3N3O4S and a molecular weight of 459.49 g/mol. Its IUPAC name is 4-[(5-methylthiophen-2-yl)methyl]-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(5-methylthiophen-2-yl)methyl]-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845849 |
| Molecular Formula | C20H24F3N3O4S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 4-[(5-methylthiophen-2-yl)methyl]-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2CCOC3C(COc4ncccn4)CCC32)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N3O2S.C2HF3O2/c1-13-3-5-15(24-13)11-21-9-10-22-17-14(4-6-16(17)21)12-23-18-19-7-2-8-20-18;3-2(4,5)1(6)7/h2-3,5,7-8,14,16-17H,4,6,9-12H2,1H3;(H,6,7) |
| InChIKey | YMJBSHCVMGTRLJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |