C18H25F3N4O4 — CID 155846137
4-[[3-(ethoxymethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid (PubChem CID 155846137) has the molecular formula C18H25F3N4O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is 4-[[3-(ethoxymethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[3-(ethoxymethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155846137 |
| Molecular Formula | C18H25F3N4O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 4-[[3-(ethoxymethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid |
| SMILES | CCOCc1cnc2n1CCN(Cc1c(C)noc1C)C2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O2.C2HF3O2/c1-5-21-10-14-8-17-16-12(3)19(6-7-20(14)16)9-15-11(2)18-22-13(15)4;3-2(4,5)1(6)7/h8,12H,5-7,9-10H2,1-4H3;(H,6,7) |
| InChIKey | ZTLRPVHJVFEAEY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |