C23H24F6N4O5S — CID 155846163
6-(pyridin-3-ylmethoxymethyl)-8-(thiophen-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155846163) has the molecular formula C23H24F6N4O5S and a molecular weight of 582.52 g/mol. Its IUPAC name is 6-(pyridin-3-ylmethoxymethyl)-8-(thiophen-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 6-(pyridin-3-ylmethoxymethyl)-8-(thiophen-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155846163 |
| Molecular Formula | C23H24F6N4O5S |
| Molecular Weight | 582.52 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | 6-(pyridin-3-ylmethoxymethyl)-8-(thiophen-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cncc(COCC2CN(Cc3cccs3)Cc3nccn3C2)c1 |
| InChI | InChI=1S/C19H22N4OS.2C2HF3O2/c1-3-16(9-20-5-1)14-24-15-17-10-22(12-18-4-2-8-25-18)13-19-21-6-7-23(19)11-17;2*3-2(4,5)1(6)7/h1-9,17H,10-15H2;2*(H,6,7) |
| InChIKey | FSMKJMQQOFGRPO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |