C25H27F6N3O7S — CID 155846755
1'-cyclobutyl-2-(pyridin-2-ylmethyl)spiro[3H-5,1λ6,2-benzoxathiazepine-4,3'-pyrrolidine] 1,1-dioxide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155846755) has the molecular formula C25H27F6N3O7S and a molecular weight of 627.56 g/mol. Its IUPAC name is 1'-cyclobutyl-2-(pyridin-2-ylmethyl)spiro[3H-5,1λ6,2-benzoxathiazepine-4,3'-pyrrolidine] 1,1-dioxide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1'-cyclobutyl-2-(pyridin-2-ylmethyl)spiro[3H-5,1λ6,2-benzoxathiazepine-4,3'-pyrrolidine] 1,1-dioxide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155846755 |
| Molecular Formula | C25H27F6N3O7S |
| Molecular Weight | 627.56 g/mol |
| Exact Mass | 627.15 |
| IUPAC Name | 1'-cyclobutyl-2-(pyridin-2-ylmethyl)spiro[3H-5,1λ6,2-benzoxathiazepine-4,3'-pyrrolidine] 1,1-dioxide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=S1(=O)c2ccccc2OC2(CCN(C3CCC3)C2)CN1Cc1ccccn1 |
| InChI | InChI=1S/C21H25N3O3S.2C2HF3O2/c25-28(26)20-10-2-1-9-19(20)27-21(11-13-23(15-21)18-7-5-8-18)16-24(28)14-17-6-3-4-12-22-17;2*3-2(4,5)1(6)7/h1-4,6,9-10,12,18H,5,7-8,11,13-16H2;2*(H,6,7) |
| InChIKey | VIIYTUAPAJIBEV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 137.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |