C20H20F3NO4S2 — CID 155846894
2-cyclobutyl-7-thiophen-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 155846894) has the molecular formula C20H20F3NO4S2 and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-cyclobutyl-7-thiophen-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-cyclobutyl-7-thiophen-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155846894 |
| Molecular Formula | C20H20F3NO4S2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 2-cyclobutyl-7-thiophen-3-yl-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S1(=O)c2ccc(-c3ccsc3)cc2C2CN(C3CCC3)CC21 |
| InChI | InChI=1S/C18H19NO2S2.C2HF3O2/c20-23(21)17-5-4-12(13-6-7-22-11-13)8-15(17)16-9-19(10-18(16)23)14-2-1-3-14;3-2(4,5)1(6)7/h4-8,11,14,16,18H,1-3,9-10H2;(H,6,7) |
| InChIKey | WSTSOJSFOUPWQA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |