C19H27F3N4O5 — CID 155847107
[(3aS,4R,7aS)-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-4-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155847107) has the molecular formula C19H27F3N4O5 and a molecular weight of 448.44 g/mol. Its IUPAC name is [(3aS,4R,7aS)-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-4-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aS,4R,7aS)-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-4-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155847107 |
| Molecular Formula | C19H27F3N4O5 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | [(3aS,4R,7aS)-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-4-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(CN2C[C@H](C(=O)N3CCCCO3)[C@@H]3CCO[C@@H]3C2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N4O3.C2HF3O2/c1-19-9-13(8-18-19)10-20-11-15(14-4-7-23-16(14)12-20)17(22)21-5-2-3-6-24-21;3-2(4,5)1(6)7/h8-9,14-16H,2-7,10-12H2,1H3;(H,6,7)/t14-,15-,16+;/m0./s1 |
| InChIKey | NFOGNBDQAHDFCP-MLZPLGHASA-N |
| XLogP | 1.44 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |