C23H23F6N5O5 — CID 155847198
(2S,3aS,6aS)-2-(5-methyl-1H-1,2,4-triazol-3-yl)-5-(quinolin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155847198) has the molecular formula C23H23F6N5O5 and a molecular weight of 563.46 g/mol. Its IUPAC name is (2S,3aS,6aS)-2-(5-methyl-1H-1,2,4-triazol-3-yl)-5-(quinolin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2S,3aS,6aS)-2-(5-methyl-1H-1,2,4-triazol-3-yl)-5-(quinolin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155847198 |
| Molecular Formula | C23H23F6N5O5 |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | (2S,3aS,6aS)-2-(5-methyl-1H-1,2,4-triazol-3-yl)-5-(quinolin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc([C@@H]2C[C@H]3CN(Cc4ccc5ccccc5n4)C[C@H]3O2)n[nH]1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21N5O.2C2HF3O2/c1-12-20-19(23-22-12)17-8-14-9-24(11-18(14)25-17)10-15-7-6-13-4-2-3-5-16(13)21-15;2*3-2(4,5)1(6)7/h2-7,14,17-18H,8-11H2,1H3,(H,20,22,23);2*(H,6,7)/t14-,17-,18+;;/m0../s1 |
| InChIKey | KBTDIYBCMRSEJA-VAYSUXKISA-N |
| XLogP | 3.89 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |