C16H11F4NO2S — CID 15584723
4,5,6,7-tetrafluoro-3-methyl-1-(4-methylphenyl)sulfonylindole (PubChem CID 15584723) has the molecular formula C16H11F4NO2S and a molecular weight of 357.33 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-3-methyl-1-(4-methylphenyl)sulfonylindole.
| Compound Name | 4,5,6,7-tetrafluoro-3-methyl-1-(4-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 15584723 |
| Molecular Formula | C16H11F4NO2S |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4,5,6,7-tetrafluoro-3-methyl-1-(4-methylphenyl)sulfonylindole |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C)c3c(F)c(F)c(F)c(F)c32)cc1 |
| InChI | InChI=1S/C16H11F4NO2S/c1-8-3-5-10(6-4-8)24(22,23)21-7-9(2)11-12(17)13(18)14(19)15(20)16(11)21/h3-7H,1-2H3 |
| InChIKey | QCLOCELUFAXHCY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|