C19H26F6N4O4 — CID 155847275
(3aR,6aS)-1-(cyclopropylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155847275) has the molecular formula C19H26F6N4O4 and a molecular weight of 488.43 g/mol. Its IUPAC name is (3aR,6aS)-1-(cyclopropylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,6aS)-1-(cyclopropylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155847275 |
| Molecular Formula | C19H26F6N4O4 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (3aR,6aS)-1-(cyclopropylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc(CN2CC[C@H]3[C@H]2CCN3CC2CC2)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4.2C2HF3O2/c1-17-9-13(8-16-17)11-19-7-5-14-15(19)4-6-18(14)10-12-2-3-12;2*3-2(4,5)1(6)7/h8-9,12,14-15H,2-7,10-11H2,1H3;2*(H,6,7)/t14-,15+;;/m0../s1 |
| InChIKey | MYGIPKJCXWMLNM-FZMMWMHASA-N |
| XLogP | 2.75 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |