C24H29F6N5O6 — CID 155847343
[6-[(4-methoxyphenyl)methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155847343) has the molecular formula C24H29F6N5O6 and a molecular weight of 597.51 g/mol. Its IUPAC name is [6-[(4-methoxyphenyl)methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [6-[(4-methoxyphenyl)methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155847343 |
| Molecular Formula | C24H29F6N5O6 |
| Molecular Weight | 597.51 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | [6-[(4-methoxyphenyl)methyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1ccc(CN2CCc3c(C(=O)N4CCN(C)CC4)n[nH]c3C2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H27N5O2.2C2HF3O2/c1-23-9-11-25(12-10-23)20(26)19-17-7-8-24(14-18(17)21-22-19)13-15-3-5-16(27-2)6-4-15;2*3-2(4,5)1(6)7/h3-6H,7-14H2,1-2H3,(H,21,22);2*(H,6,7) |
| InChIKey | GGOHBCFMIPNJMI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 139.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |