C22H29F3N2O4 — CID 155847421
2-[(3aS,6aR)-5-cyclobutyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N-(2-phenylethyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155847421) has the molecular formula C22H29F3N2O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-cyclobutyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N-(2-phenylethyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3aS,6aR)-5-cyclobutyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N-(2-phenylethyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155847421 |
| Molecular Formula | C22H29F3N2O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-[(3aS,6aR)-5-cyclobutyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N-(2-phenylethyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C[C@]12COC[C@H]1CN(C1CCC1)C2)NCCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N2O2.C2HF3O2/c23-19(21-10-9-16-5-2-1-3-6-16)11-20-14-22(18-7-4-8-18)12-17(20)13-24-15-20;3-2(4,5)1(6)7/h1-3,5-6,17-18H,4,7-15H2,(H,21,23);(H,6,7)/t17-,20+;/m1./s1 |
| InChIKey | AIPGEHCFJQTTND-XLCHORMMSA-N |
| XLogP | 2.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |