C21H31F3N2O3 — CID 155847661
(5R,9R)-2-[(2,5-dimethylphenyl)methyl]-N,N-dimethyl-6-oxa-2-azaspiro[4.5]decan-9-amine;2,2,2-trifluoroacetic acid (PubChem CID 155847661) has the molecular formula C21H31F3N2O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is (5R,9R)-2-[(2,5-dimethylphenyl)methyl]-N,N-dimethyl-6-oxa-2-azaspiro[4.5]decan-9-amine;2,2,2-trifluoroacetic acid.
| Compound Name | (5R,9R)-2-[(2,5-dimethylphenyl)methyl]-N,N-dimethyl-6-oxa-2-azaspiro[4.5]decan-9-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155847661 |
| Molecular Formula | C21H31F3N2O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (5R,9R)-2-[(2,5-dimethylphenyl)methyl]-N,N-dimethyl-6-oxa-2-azaspiro[4.5]decan-9-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C)c(CN2CC[C@@]3(C[C@H](N(C)C)CCO3)C2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H30N2O.C2HF3O2/c1-15-5-6-16(2)17(11-15)13-21-9-8-19(14-21)12-18(20(3)4)7-10-22-19;3-2(4,5)1(6)7/h5-6,11,18H,7-10,12-14H2,1-4H3;(H,6,7)/t18-,19-;/m1./s1 |
| InChIKey | OBRBZYIXZMUGHG-STYNFMPRSA-N |
| XLogP | 3.62 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |