C20H27F9N4O7S — CID 155847739
2-[(4aR,7aS)-6-(1,3-thiazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylethanamine;tris(2,2,2-trifluoroacetic acid) (PubChem CID 155847739) has the molecular formula C20H27F9N4O7S and a molecular weight of 638.51 g/mol. Its IUPAC name is 2-[(4aR,7aS)-6-(1,3-thiazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylethanamine;tris(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(4aR,7aS)-6-(1,3-thiazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylethanamine;tris(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155847739 |
| Molecular Formula | C20H27F9N4O7S |
| Molecular Weight | 638.51 g/mol |
| Exact Mass | 638.15 |
| IUPAC Name | 2-[(4aR,7aS)-6-(1,3-thiazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylethanamine;tris(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCN1CCO[C@H]2CN(Cc3nccs3)C[C@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H24N4OS.3C2HF3O2/c1-16(2)4-5-18-6-7-19-13-10-17(9-12(13)18)11-14-15-3-8-20-14;3*3-2(4,5)1(6)7/h3,8,12-13H,4-7,9-11H2,1-2H3;3*(H,6,7)/t12-,13+;;;/m1.../s1 |
| InChIKey | GKOIUCUAAMFRDU-JIKQGSGNSA-N |
| XLogP | 2.49 |
| TPSA | 143.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |