C18H20F3N3O3S2 — CID 155847746
(3aS,6aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(thiophen-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155847746) has the molecular formula C18H20F3N3O3S2 and a molecular weight of 447.50 g/mol. Its IUPAC name is (3aS,6aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(thiophen-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(thiophen-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155847746 |
| Molecular Formula | C18H20F3N3O3S2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | (3aS,6aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(thiophen-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C(=O)C[C@@H]3[C@@H]2CCN3Cc2ccsc2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H19N3OS2.C2HF3O2/c1-11-17-13(10-22-11)8-19-14-2-4-18(15(14)6-16(19)20)7-12-3-5-21-9-12;3-2(4,5)1(6)7/h3,5,9-10,14-15H,2,4,6-8H2,1H3;(H,6,7)/t14-,15+;/m0./s1 |
| InChIKey | ODAKSVQTDUIFQZ-LDXVYITESA-N |
| XLogP | 3.52 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |