C17H24F3N3O4S — CID 155848592
(4R,4aR,8aR)-N-methyl-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155848592) has the molecular formula C17H24F3N3O4S and a molecular weight of 423.46 g/mol. Its IUPAC name is (4R,4aR,8aR)-N-methyl-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4R,4aR,8aR)-N-methyl-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848592 |
| Molecular Formula | C17H24F3N3O4S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (4R,4aR,8aR)-N-methyl-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)[C@@H]1CCO[C@@H]2CCN(Cc3scnc3C)C[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O2S.C2HF3O2/c1-10-14(21-9-17-10)8-18-5-3-13-12(7-18)11(4-6-20-13)15(19)16-2;3-2(4,5)1(6)7/h9,11-13H,3-8H2,1-2H3,(H,16,19);(H,6,7)/t11-,12+,13-;/m1./s1 |
| InChIKey | ISBMTUINKHXCKO-YKMYWEBLSA-N |
| XLogP | 2.06 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |