C15H22F3N3O4 — CID 155848811
6-(methoxymethyl)-8-(oxolan-3-yl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;2,2,2-trifluoroacetic acid (PubChem CID 155848811) has the molecular formula C15H22F3N3O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is 6-(methoxymethyl)-8-(oxolan-3-yl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-(methoxymethyl)-8-(oxolan-3-yl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848811 |
| Molecular Formula | C15H22F3N3O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 6-(methoxymethyl)-8-(oxolan-3-yl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
| SMILES | COCC1CN(C2CCOC2)Cc2nccn2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H21N3O2.C2HF3O2/c1-17-9-11-6-15-4-3-14-13(15)8-16(7-11)12-2-5-18-10-12;3-2(4,5)1(6)7/h3-4,11-12H,2,5-10H2,1H3;(H,6,7) |
| InChIKey | SDZRYJKIZWCEDO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |