About [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium
[(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium (PubChem CID 15584888) has the molecular formula C16H32N+
and a molecular weight of 238.44 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium.
Molecular Properties
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium |
| PubChem CID | 15584888 |
| Molecular Formula | C16H32N+ |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 238.25 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H32N/c1-7-17(8-2,9-3)14-13-16(6)12-10-11-15(4)5/h11,13H,7-10,12,14H2,1-6H3/q+1/b16-13+ |
| InChIKey | AEARGKNKGVVMRH-DTQAZKPQSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium?
The IUPAC name of [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium (CID 15584888) is [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium.
What is the SMILES notation for [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium?
The canonical SMILES for [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium is CC[N+](CC)(CC)C/C=C(\C)CCC=C(C)C.
What is the InChIKey of [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium?
The InChIKey is AEARGKNKGVVMRH-DTQAZKPQSA-N. The full InChI is InChI=1S/C16H32N/c1-7-17(8-2,9-3)14-13-16(6)12-10-11-15(4)5/h11,13H,7-10,12,14H2,1-6H3/q+1/b16-13+.
What are the key properties of [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium?
[(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium has a molecular weight of 238.44 g/mol, XLogP of 4.56, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-3,7-dimethylocta-2,6-dienyl]-triethylazanium is sourced from PubChem (CID 15584888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).