C17H21F3N4O4 — CID 155848932
[(3aR,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(oxolan-3-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155848932) has the molecular formula C17H21F3N4O4 and a molecular weight of 402.37 g/mol. Its IUPAC name is [(3aR,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(oxolan-3-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(oxolan-3-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848932 |
| Molecular Formula | C17H21F3N4O4 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [(3aR,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(oxolan-3-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C1CCOC1)N1CC[C@H]2[C@H]1CCN2c1ncccn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H20N4O2.C2HF3O2/c20-14(11-4-9-21-10-11)18-7-2-13-12(18)3-8-19(13)15-16-5-1-6-17-15;3-2(4,5)1(6)7/h1,5-6,11-13H,2-4,7-10H2;(H,6,7)/t11?,12-,13+;/m1./s1 |
| InChIKey | JQGGAPWZJNJANB-VHBLZNKNSA-N |
| XLogP | 1.33 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |