C21H27F3N4O5 — CID 155849101
ethyl (3aR,8aR)-2-prop-2-enyl-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 155849101) has the molecular formula C21H27F3N4O5 and a molecular weight of 472.46 g/mol. Its IUPAC name is ethyl (3aR,8aR)-2-prop-2-enyl-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl (3aR,8aR)-2-prop-2-enyl-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155849101 |
| Molecular Formula | C21H27F3N4O5 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | ethyl (3aR,8aR)-2-prop-2-enyl-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | C=CCN1C[C@@H]2CN(C(=O)c3cnccn3)CCC[C@]2(C(=O)OCC)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N4O3.C2HF3O2/c1-3-9-22-12-15-13-23(17(24)16-11-20-7-8-21-16)10-5-6-19(15,14-22)18(25)26-4-2;3-2(4,5)1(6)7/h3,7-8,11,15H,1,4-6,9-10,12-14H2,2H3;(H,6,7)/t15-,19+;/m1./s1 |
| InChIKey | ORYQUIUMUBKBDX-WSCVZUBPSA-N |
| XLogP | 2.01 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|