C18H18F3N3O3S — CID 155849516
5-phenyl-2-(1,3-thiazol-2-ylmethyl)-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid (PubChem CID 155849516) has the molecular formula C18H18F3N3O3S and a molecular weight of 413.42 g/mol. Its IUPAC name is 5-phenyl-2-(1,3-thiazol-2-ylmethyl)-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-phenyl-2-(1,3-thiazol-2-ylmethyl)-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155849516 |
| Molecular Formula | C18H18F3N3O3S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 5-phenyl-2-(1,3-thiazol-2-ylmethyl)-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1C2CN(Cc3nccs3)CC2CN1c1ccccc1 |
| InChI | InChI=1S/C16H17N3OS.C2HF3O2/c20-16-14-10-18(11-15-17-6-7-21-15)8-12(14)9-19(16)13-4-2-1-3-5-13;3-2(4,5)1(6)7/h1-7,12,14H,8-11H2;(H,6,7) |
| InChIKey | LSNLWKSQDLGFRW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |