C12H22ClNO2 — CID 155849853
4a-(prop-2-enoxymethyl)-2,3,4,5,6,7,8,8a-octahydropyrano[3,2-c]pyridine;hydrochloride (PubChem CID 155849853) has the molecular formula C12H22ClNO2 and a molecular weight of 247.77 g/mol. Its IUPAC name is 4a-(prop-2-enoxymethyl)-2,3,4,5,6,7,8,8a-octahydropyrano[3,2-c]pyridine;hydrochloride.
| Compound Name | 4a-(prop-2-enoxymethyl)-2,3,4,5,6,7,8,8a-octahydropyrano[3,2-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 155849853 |
| Molecular Formula | C12H22ClNO2 |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 4a-(prop-2-enoxymethyl)-2,3,4,5,6,7,8,8a-octahydropyrano[3,2-c]pyridine;hydrochloride |
| SMILES | C=CCOCC12CCCOC1CCNC2.Cl |
| InChI | InChI=1S/C12H21NO2.ClH/c1-2-7-14-10-12-5-3-8-15-11(12)4-6-13-9-12;/h2,11,13H,1,3-10H2;1H |
| InChIKey | SUYAJUJLFPYNGM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|