C22H32F3N5O4S — CID 155850112
3-ethyl-N,N-dimethyl-4-oxo-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecane-13-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155850112) has the molecular formula C22H32F3N5O4S and a molecular weight of 519.59 g/mol. Its IUPAC name is 3-ethyl-N,N-dimethyl-4-oxo-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecane-13-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-ethyl-N,N-dimethyl-4-oxo-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecane-13-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155850112 |
| Molecular Formula | C22H32F3N5O4S |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 3-ethyl-N,N-dimethyl-4-oxo-9-(1,3-thiazol-2-ylmethyl)-3,9,13-triazadispiro[4.0.56.35]tetradecane-13-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CCC2(CN(C(=O)N(C)C)CC23CCN(Cc2nccs2)CC3)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H31N5O2S.C2HF3O2/c1-4-24-11-7-20(17(24)26)15-25(18(27)22(2)3)14-19(20)5-9-23(10-6-19)13-16-21-8-12-28-16;3-2(4,5)1(6)7/h8,12H,4-7,9-11,13-15H2,1-3H3;(H,6,7) |
| InChIKey | RRZBVRAYUGSOCQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |