C21H27F6N7O5 — CID 155850259
2-(dimethylamino)-1-[7-[2-(pyrimidin-2-ylamino)ethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155850259) has the molecular formula C21H27F6N7O5 and a molecular weight of 571.48 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[7-[2-(pyrimidin-2-ylamino)ethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(dimethylamino)-1-[7-[2-(pyrimidin-2-ylamino)ethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155850259 |
| Molecular Formula | C21H27F6N7O5 |
| Molecular Weight | 571.48 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 2-(dimethylamino)-1-[7-[2-(pyrimidin-2-ylamino)ethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CC(=O)N1Cc2ccnn2CC(CCNc2ncccn2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N7O.2C2HF3O2/c1-22(2)13-16(25)23-10-14(11-24-15(12-23)5-9-21-24)4-8-20-17-18-6-3-7-19-17;2*3-2(4,5)1(6)7/h3,5-7,9,14H,4,8,10-13H2,1-2H3,(H,18,19,20);2*(H,6,7) |
| InChIKey | VZTKNIUBPBNWIG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |