C19H24F6N4O5 — CID 155851082
2-(cyclopropylmethylamino)-N-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155851082) has the molecular formula C19H24F6N4O5 and a molecular weight of 502.41 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(cyclopropylmethylamino)-N-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155851082 |
| Molecular Formula | C19H24F6N4O5 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CNC(=O)c1cc2c(nc1NCC1CC1)CCNCC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N4O.2C2HF3O2/c1-16-15(20)12-8-11-4-6-17-7-5-13(11)19-14(12)18-9-10-2-3-10;2*3-2(4,5)1(6)7/h8,10,17H,2-7,9H2,1H3,(H,16,20)(H,18,19);2*(H,6,7) |
| InChIKey | UDNBHYMFFBQBCU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |