C20H28F3N3O5 — CID 155851487
N-butyl-3-pyridin-3-yloxy-1-oxa-8-azaspiro[4.5]decane-8-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155851487) has the molecular formula C20H28F3N3O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is N-butyl-3-pyridin-3-yloxy-1-oxa-8-azaspiro[4.5]decane-8-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-3-pyridin-3-yloxy-1-oxa-8-azaspiro[4.5]decane-8-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155851487 |
| Molecular Formula | C20H28F3N3O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-butyl-3-pyridin-3-yloxy-1-oxa-8-azaspiro[4.5]decane-8-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNC(=O)N1CCC2(CC1)CC(Oc1cccnc1)CO2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O3.C2HF3O2/c1-2-3-9-20-17(22)21-10-6-18(7-11-21)12-16(14-23-18)24-15-5-4-8-19-13-15;3-2(4,5)1(6)7/h4-5,8,13,16H,2-3,6-7,9-12,14H2,1H3,(H,20,22);(H,6,7) |
| InChIKey | PWVXWAVPPGEGBM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|