C23H23F6N5O7 — CID 155852896
6-[2-[(3R,3aR,6aR)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]pyridine-3-carbonitrile;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155852896) has the molecular formula C23H23F6N5O7 and a molecular weight of 595.45 g/mol. Its IUPAC name is 6-[2-[(3R,3aR,6aR)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]pyridine-3-carbonitrile;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 6-[2-[(3R,3aR,6aR)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]pyridine-3-carbonitrile;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155852896 |
| Molecular Formula | C23H23F6N5O7 |
| Molecular Weight | 595.45 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | 6-[2-[(3R,3aR,6aR)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]ethoxy]pyridine-3-carbonitrile;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1cc(N2C[C@H]3[C@@H](CCOc4ccc(C#N)cn4)CO[C@H]3C2)ncn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21N5O3.2C2HF3O2/c1-25-19-6-17(22-12-23-19)24-9-15-14(11-27-16(15)10-24)4-5-26-18-3-2-13(7-20)8-21-18;2*3-2(4,5)1(6)7/h2-3,6,8,12,14-16H,4-5,9-11H2,1H3;2*(H,6,7)/t14-,15-,16-;;/m0../s1 |
| InChIKey | WPYZLOLTKSDDJM-SLIQCDJCSA-N |
| XLogP | 2.94 |
| TPSA | 167.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |